C35H45N5O4 — CID 157055188
9-[4-[[4-[[4-(1,3-oxazinan-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]nonyl butanoate (PubChem CID 157055188) has the molecular formula C35H45N5O4 and a molecular weight of 599.78 g/mol. Its IUPAC name is 9-[4-[[4-[[4-(1,3-oxazinan-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]nonyl butanoate.
| Compound Name | 9-[4-[[4-[[4-(1,3-oxazinan-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]nonyl butanoate |
|---|---|
| PubChem CID | 157055188 |
| Molecular Formula | C35H45N5O4 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | 9-[4-[[4-[[4-(1,3-oxazinan-3-yl)phenyl]diazenyl]phenyl]diazenyl]phenoxy]nonyl butanoate |
| SMILES | CCCC(=O)OCCCCCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(N4CCCOC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H45N5O4/c1-2-11-35(41)44-27-9-7-5-3-4-6-8-26-43-34-22-18-32(19-23-34)39-37-30-14-12-29(13-15-30)36-38-31-16-20-33(21-17-31)40-24-10-25-42-28-40/h12-23H,2-11,24-28H2,1H3/b38-36+,39-37+ |
| InChIKey | DRBPIIQVENYJJY-NFSGFYSESA-N |
| XLogP | 10.15 |
| TPSA | 97.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|