C31H37N5O4 — CID 166512675
5-[4-[[4-[(2-methyl-4-morpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate (PubChem CID 166512675) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is 5-[4-[[4-[(2-methyl-4-morpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate.
| Compound Name | 5-[4-[[4-[(2-methyl-4-morpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate |
|---|---|
| PubChem CID | 166512675 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 5-[4-[[4-[(2-methyl-4-morpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]pentyl propanoate |
| SMILES | CCC(=O)OCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(N4CCOCC4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C31H37N5O4/c1-3-31(37)40-20-6-4-5-19-39-29-14-11-27(12-15-29)33-32-25-7-9-26(10-8-25)34-35-30-16-13-28(23-24(30)2)36-17-21-38-22-18-36/h7-16,23H,3-6,17-22H2,1-2H3/b33-32+,35-34+ |
| InChIKey | BNPOVNKGCJPZIT-VPHDGDOJSA-N |
| XLogP | 8.16 |
| TPSA | 97.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|