C36H42N6O2 — CID 139387004
(4-butoxyphenyl)-[4-[4-[4-[(4-butoxyphenyl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene (PubChem CID 139387004) has the molecular formula C36H42N6O2 and a molecular weight of 590.77 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-[4-[4-[(4-butoxyphenyl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene.
| Compound Name | (4-butoxyphenyl)-[4-[4-[4-[(4-butoxyphenyl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene |
|---|---|
| PubChem CID | 139387004 |
| Molecular Formula | C36H42N6O2 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | (4-butoxyphenyl)-[4-[4-[4-[(4-butoxyphenyl)diazenyl]phenyl]piperazin-1-yl]phenyl]diazene |
| SMILES | CCCCOc1ccc(/N=N/c2ccc(N3CCN(c4ccc(/N=N/c5ccc(OCCCC)cc5)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H42N6O2/c1-3-5-27-43-35-19-11-31(12-20-35)39-37-29-7-15-33(16-8-29)41-23-25-42(26-24-41)34-17-9-30(10-18-34)38-40-32-13-21-36(22-14-32)44-28-6-4-2/h7-22H,3-6,23-28H2,1-2H3/b39-37+,40-38+ |
| InChIKey | BUPJSBAWHHCAGD-HVMBLDELSA-N |
| XLogP | 10.20 |
| TPSA | 74.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|