C34H43N5O3S — CID 156628724
9-[4-[[4-[(4-thiomorpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]nonyl propanoate (PubChem CID 156628724) has the molecular formula C34H43N5O3S and a molecular weight of 601.82 g/mol. Its IUPAC name is 9-[4-[[4-[(4-thiomorpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]nonyl propanoate.
| Compound Name | 9-[4-[[4-[(4-thiomorpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]nonyl propanoate |
|---|---|
| PubChem CID | 156628724 |
| Molecular Formula | C34H43N5O3S |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | 9-[4-[[4-[(4-thiomorpholin-4-ylphenyl)diazenyl]phenyl]diazenyl]phenoxy]nonyl propanoate |
| SMILES | CCC(=O)OCCCCCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(N4CCSCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H43N5O3S/c1-2-34(40)42-25-9-7-5-3-4-6-8-24-41-33-20-16-31(17-21-33)38-36-29-12-10-28(11-13-29)35-37-30-14-18-32(19-15-30)39-22-26-43-27-23-39/h10-21H,2-9,22-27H2,1H3/b37-35+,38-36+ |
| InChIKey | DCOIPYSVOALMLG-ATXIYDNESA-N |
| XLogP | 10.13 |
| TPSA | 88.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|