C35H45N5O5 — CID 164806359
2-[4-[[4-[[4-(9-acetyloxynonoxy)phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl propanoate (PubChem CID 164806359) has the molecular formula C35H45N5O5 and a molecular weight of 615.78 g/mol. Its IUPAC name is 2-[4-[[4-[[4-(9-acetyloxynonoxy)phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl propanoate.
| Compound Name | 2-[4-[[4-[[4-(9-acetyloxynonoxy)phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl propanoate |
|---|---|
| PubChem CID | 164806359 |
| Molecular Formula | C35H45N5O5 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | 2-[4-[[4-[[4-(9-acetyloxynonoxy)phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl propanoate |
| SMILES | CCC(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(OCCCCCCCCCOC(C)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H45N5O5/c1-4-35(42)45-27-24-40(3)33-20-16-31(17-21-33)38-36-29-12-14-30(15-13-29)37-39-32-18-22-34(23-19-32)44-26-11-9-7-5-6-8-10-25-43-28(2)41/h12-23H,4-11,24-27H2,1-3H3/b38-36+,39-37+ |
| InChIKey | KEOIADDTLYGGJB-NFSGFYSESA-N |
| XLogP | 9.58 |
| TPSA | 114.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|