C18H22N4O3 — CID 163526628
2-[N-methyl-4-[2-(4-nitrosophenyl)hydrazinyl]anilino]ethyl propanoate (PubChem CID 163526628) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[N-methyl-4-[2-(4-nitrosophenyl)hydrazinyl]anilino]ethyl propanoate.
| Compound Name | 2-[N-methyl-4-[2-(4-nitrosophenyl)hydrazinyl]anilino]ethyl propanoate |
|---|---|
| PubChem CID | 163526628 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[N-methyl-4-[2-(4-nitrosophenyl)hydrazinyl]anilino]ethyl propanoate |
| SMILES | CCC(=O)OCCN(C)c1ccc(NNc2ccc(N=O)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c1-3-18(23)25-13-12-22(2)17-10-8-15(9-11-17)20-19-14-4-6-16(21-24)7-5-14/h4-11,19-20H,3,12-13H2,1-2H3 |
| InChIKey | KSRMILLCZPQZJF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|