About 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine
1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine (PubChem CID 174952140) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine |
| PubChem CID | 174952140 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine |
| SMILES | CNc1ccc(N(C)c2ccc(N=O)cc2)cc1 |
| InChI | InChI=1S/C14H15N3O/c1-15-11-3-7-13(8-4-11)17(2)14-9-5-12(16-18)6-10-14/h3-10,15H,1-2H3 |
| InChIKey | CIEUEDULLRGIST-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine?
The IUPAC name of 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine (CID 174952140) is 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine.
What is the SMILES notation for 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine?
The canonical SMILES for 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine is CNc1ccc(N(C)c2ccc(N=O)cc2)cc1.
What is the InChIKey of 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine?
The InChIKey is CIEUEDULLRGIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-15-11-3-7-13(8-4-11)17(2)14-9-5-12(16-18)6-10-14/h3-10,15H,1-2H3.
What are the key properties of 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine?
1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine has a molecular weight of 241.29 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-dimethyl-4-N-(4-nitrosophenyl)benzene-1,4-diamine is sourced from PubChem (CID 174952140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).