About 4-nitro-N-phenylaniline
4-nitro-N-phenylaniline (PubChem CID 13271) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-nitro-N-phenylaniline.
Molecular Properties
| Compound Name | 4-nitro-N-phenylaniline |
| PubChem CID | 13271 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-nitro-N-phenylaniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2O2/c15-14(16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | XXYMSQQCBUKFHE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-phenylaniline?
The IUPAC name of 4-nitro-N-phenylaniline (CID 13271) is 4-nitro-N-phenylaniline.
What is the SMILES notation for 4-nitro-N-phenylaniline?
The canonical SMILES for 4-nitro-N-phenylaniline is O=[N+]([O-])c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 4-nitro-N-phenylaniline?
The InChIKey is XXYMSQQCBUKFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-14(16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13H.
What are the key properties of 4-nitro-N-phenylaniline?
4-nitro-N-phenylaniline has a molecular weight of 214.22 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-phenylaniline is sourced from PubChem (CID 13271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).