About 4,4'-Dinitrocarbanilide
4,4'-Dinitrocarbanilide (PubChem CID 9509) has the molecular formula C13H10N4O5
and a molecular weight of 302.24 g/mol. Its IUPAC name is 1,3-bis(4-nitrophenyl)urea.
Molecular Properties
| Compound Name | 4,4'-Dinitrocarbanilide |
| PubChem CID | 9509 |
| Molecular Formula | C13H10N4O5 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1,3-bis(4-nitrophenyl)urea |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) |
| InChIKey | JEZZOKXIXNSKQD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | 379 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4'-Dinitrocarbanilide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4'-Dinitrocarbanilide?
The IUPAC name of 4,4'-Dinitrocarbanilide (CID 9509) is 1,3-bis(4-nitrophenyl)urea.
What is the SMILES notation for 4,4'-Dinitrocarbanilide?
The canonical SMILES for 4,4'-Dinitrocarbanilide is C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 4,4'-Dinitrocarbanilide?
The InChIKey is JEZZOKXIXNSKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18).
What are the key properties of 4,4'-Dinitrocarbanilide?
4,4'-Dinitrocarbanilide has a molecular weight of 302.24 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4'-Dinitrocarbanilide is sourced from PubChem (CID 9509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).