C29H36N6O4 — CID 142226495
2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2-methylpropanoate (PubChem CID 142226495) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is 2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2-methylpropanoate.
| Compound Name | 2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 142226495 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-[4-[[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(N(CCO)CCO)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H36N6O4/c1-22(2)29(38)39-21-18-34(3)27-12-8-25(9-13-27)32-30-23-4-6-24(7-5-23)31-33-26-10-14-28(15-11-26)35(16-19-36)17-20-37/h4-15,22,36-37H,16-21H2,1-3H3/b32-30+,33-31+ |
| InChIKey | FRQUCIJSGHFOJQ-RRPBDJRISA-N |
| XLogP | 5.94 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|