C29H31N5O2 — CID 58322524
2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate (PubChem CID 58322524) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58322524 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate |
| SMILES | C#Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(N(C)CCOC(=O)C(C)(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H31N5O2/c1-6-22-8-10-23(11-9-22)30-31-24-12-14-25(15-13-24)32-33-26-16-18-27(19-17-26)34(5)20-21-36-28(35)29(3,4)7-2/h1,8-19H,7,20-21H2,2-5H3/b31-30+,33-32+ |
| InChIKey | MZUZBJWEUSPRLP-CJQWSLHQSA-N |
| XLogP | 7.91 |
| TPSA | 78.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|