C32H37N5O2 — CID 58251110
2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2,4,4-tetramethylpentanoate (PubChem CID 58251110) has the molecular formula C32H37N5O2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2,4,4-tetramethylpentanoate.
| Compound Name | 2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 58251110 |
| Molecular Formula | C32H37N5O2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 2-[4-[[4-[(4-ethynylphenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]ethyl 2,2,4,4-tetramethylpentanoate |
| SMILES | C#Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(N(C)CCOC(=O)C(C)(C)CC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H37N5O2/c1-8-24-9-11-25(12-10-24)33-34-26-13-15-27(16-14-26)35-36-28-17-19-29(20-18-28)37(7)21-22-39-30(38)32(5,6)23-31(2,3)4/h1,9-20H,21-23H2,2-7H3/b34-33+,36-35+ |
| InChIKey | JMHFHVBKCLELFP-WXBFSDFVSA-N |
| XLogP | 8.94 |
| TPSA | 78.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|