C31H39N7O4 — CID 134516826
2-[N-methyl-4-[[4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethyl 2-(2-aminopropan-2-yl)-2,3,3-trimethylbutanoate (PubChem CID 134516826) has the molecular formula C31H39N7O4 and a molecular weight of 573.70 g/mol. Its IUPAC name is 2-[N-methyl-4-[[4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethyl 2-(2-aminopropan-2-yl)-2,3,3-trimethylbutanoate.
| Compound Name | 2-[N-methyl-4-[[4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethyl 2-(2-aminopropan-2-yl)-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 134516826 |
| Molecular Formula | C31H39N7O4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 2-[N-methyl-4-[[4-[(4-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethyl 2-(2-aminopropan-2-yl)-2,3,3-trimethylbutanoate |
| SMILES | CN(CCOC(=O)C(C)(C(C)(C)C)C(C)(C)N)c1ccc(/N=N/c2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C31H39N7O4/c1-29(2,3)31(6,30(4,5)32)28(39)42-21-20-37(7)26-16-12-24(13-17-26)35-33-22-8-10-23(11-9-22)34-36-25-14-18-27(19-15-25)38(40)41/h8-19H,20-21,32H2,1-7H3/b35-33+,36-34+ |
| InChIKey | JJAXEGCYLZCLJU-LBYUQGKWSA-N |
| XLogP | 8.19 |
| TPSA | 148.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|