C37H49N7O3 — CID 161275025
2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide (PubChem CID 161275025) has the molecular formula C37H49N7O3 and a molecular weight of 639.85 g/mol. Its IUPAC name is 2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide.
| Compound Name | 2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide |
|---|---|
| PubChem CID | 161275025 |
| Molecular Formula | C37H49N7O3 |
| Molecular Weight | 639.85 g/mol |
| Exact Mass | 639.39 |
| IUPAC Name | 2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)C.CCC(C)(C)C(=O)OCCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(C#N)cc3)cc2C)cc1 |
| InChI | InChI=1S/C29H32N6O2.C8H17NO/c1-6-29(3,4)28(36)37-18-17-35(5)26-14-11-24(12-15-26)32-34-27-16-13-25(19-21(27)2)33-31-23-9-7-22(20-30)8-10-23;1-6-8(2,3)7(10)9(4)5/h7-16,19H,6,17-18H2,1-5H3;6H2,1-5H3/b33-31+,34-32+; |
| InChIKey | VEIAPVXUWCLVNP-KQOFJJDPSA-N |
| XLogP | 9.62 |
| TPSA | 123.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.85 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|