C44H40N10O4 — CID 91185357
4-[(4-cyanophenyl)diazenyl]-2-methylbenzonitrile;2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-(2,3-dihydroxypropyl)anilino]ethyl 2-methylprop-2-enoate (PubChem CID 91185357) has the molecular formula C44H40N10O4 and a molecular weight of 772.87 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)diazenyl]-2-methylbenzonitrile;2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-(2,3-dihydroxypropyl)anilino]ethyl 2-methylprop-2-enoate.
| Compound Name | 4-[(4-cyanophenyl)diazenyl]-2-methylbenzonitrile;2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-(2,3-dihydroxypropyl)anilino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91185357 |
| Molecular Formula | C44H40N10O4 |
| Molecular Weight | 772.87 g/mol |
| Exact Mass | 772.32 |
| IUPAC Name | 4-[(4-cyanophenyl)diazenyl]-2-methylbenzonitrile;2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-(2,3-dihydroxypropyl)anilino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(CC(O)CO)c1ccc(/N=N/c2ccc(/N=N/c3ccc(C#N)cc3)cc2C)cc1.Cc1cc(/N=N/c2ccc(C#N)cc2)ccc1C#N |
| InChI | InChI=1S/C29H30N6O4.C15H10N4/c1-20(2)29(38)39-15-14-35(18-27(37)19-36)26-11-8-24(9-12-26)32-34-28-13-10-25(16-21(28)3)33-31-23-6-4-22(17-30)5-7-23;1-11-8-15(7-4-13(11)10-17)19-18-14-5-2-12(9-16)3-6-14/h4-13,16,27,36-37H,1,14-15,18-19H2,2-3H3;2-8H,1H3/b33-31+,34-32+;19-18+ |
| InChIKey | KUBDOEJDNZCJRY-JVAYWKITSA-N |
| XLogP | 10.13 |
| TPSA | 215.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.87 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|