C29H33N7O — CID 89374958
(2R)-N-[2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl]-N,2-dimethylbutanamide (PubChem CID 89374958) has the molecular formula C29H33N7O and a molecular weight of 495.63 g/mol. Its IUPAC name is (2R)-N-[2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl]-N,2-dimethylbutanamide.
| Compound Name | (2R)-N-[2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 89374958 |
| Molecular Formula | C29H33N7O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (2R)-N-[2-[4-[[4-[(4-cyanophenyl)diazenyl]-2-methylphenyl]diazenyl]-N-methylanilino]ethyl]-N,2-dimethylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N(C)CCN(C)c1ccc(/N=N/c2ccc(/N=N/c3ccc(C#N)cc3)cc2C)cc1 |
| InChI | InChI=1S/C29H33N7O/c1-6-21(2)29(37)36(5)18-17-35(4)27-14-11-25(12-15-27)32-34-28-16-13-26(19-22(28)3)33-31-24-9-7-23(20-30)8-10-24/h7-16,19,21H,6,17-18H2,1-5H3/b33-31+,34-32+/t21-/m1/s1 |
| InChIKey | CZGYLHQUWBRWLV-KJUDFIEXSA-N |
| XLogP | 7.64 |
| TPSA | 96.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|