C47H57N5O5 — CID 161263916
2-[4-[(4-cyanophenyl)diazenyl]-N-methylanilino]ethyl 2-ethyl-2-methylpentanoate;2-[4-(4-cyanophenyl)phenoxy]ethyl 2-ethyl-2-methylpentanoate (PubChem CID 161263916) has the molecular formula C47H57N5O5 and a molecular weight of 772.00 g/mol. Its IUPAC name is 2-[4-[(4-cyanophenyl)diazenyl]-N-methylanilino]ethyl 2-ethyl-2-methylpentanoate;2-[4-(4-cyanophenyl)phenoxy]ethyl 2-ethyl-2-methylpentanoate.
| Compound Name | 2-[4-[(4-cyanophenyl)diazenyl]-N-methylanilino]ethyl 2-ethyl-2-methylpentanoate;2-[4-(4-cyanophenyl)phenoxy]ethyl 2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 161263916 |
| Molecular Formula | C47H57N5O5 |
| Molecular Weight | 772.00 g/mol |
| Exact Mass | 771.44 |
| IUPAC Name | 2-[4-[(4-cyanophenyl)diazenyl]-N-methylanilino]ethyl 2-ethyl-2-methylpentanoate;2-[4-(4-cyanophenyl)phenoxy]ethyl 2-ethyl-2-methylpentanoate |
| SMILES | CCCC(C)(CC)C(=O)OCCN(C)c1ccc(/N=N/c2ccc(C#N)cc2)cc1.CCCC(C)(CC)C(=O)OCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H30N4O2.C23H27NO3/c1-5-15-24(3,6-2)23(29)30-17-16-28(4)22-13-11-21(12-14-22)27-26-20-9-7-19(18-25)8-10-20;1-4-14-23(3,5-2)22(25)27-16-15-26-21-12-10-20(11-13-21)19-8-6-18(17-24)7-9-19/h7-14H,5-6,15-17H2,1-4H3;6-13H,4-5,14-16H2,1-3H3/b27-26+; |
| InChIKey | VCXMYTJSGWFPDU-JGUILPGDSA-N |
| XLogP | 11.53 |
| TPSA | 137.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.00 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|