C31H39N5O4 — CID 59046430
2-[4-[amino-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]carbamoyl]phenoxy]ethyl 2-ethyl-2-methylpentanoate (PubChem CID 59046430) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is 2-[4-[amino-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]carbamoyl]phenoxy]ethyl 2-ethyl-2-methylpentanoate.
| Compound Name | 2-[4-[amino-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]carbamoyl]phenoxy]ethyl 2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 59046430 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | 2-[4-[amino-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]carbamoyl]phenoxy]ethyl 2-ethyl-2-methylpentanoate |
| SMILES | CCCC(C)(CC)C(=O)OCCOc1ccc(C(=O)N(N)c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H39N5O4/c1-6-20-31(3,7-2)30(38)40-22-21-39-28-18-8-23(9-19-28)29(37)36(32)27-16-12-25(13-17-27)34-33-24-10-14-26(15-11-24)35(4)5/h8-19H,6-7,20-22,32H2,1-5H3/b34-33+ |
| InChIKey | QMXDYFVVHYBCAW-JEIPZWNWSA-N |
| XLogP | 6.83 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|