C43H54O5 — CID 145231729
2-[4-[9-[4-(2-methoxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl 2-ethyl-2-methylpentanoate;pentane (PubChem CID 145231729) has the molecular formula C43H54O5 and a molecular weight of 650.90 g/mol. Its IUPAC name is 2-[4-[9-[4-(2-methoxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl 2-ethyl-2-methylpentanoate;pentane.
| Compound Name | 2-[4-[9-[4-(2-methoxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl 2-ethyl-2-methylpentanoate;pentane |
|---|---|
| PubChem CID | 145231729 |
| Molecular Formula | C43H54O5 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | 2-[4-[9-[4-(2-methoxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl 2-ethyl-2-methylpentanoate;pentane |
| SMILES | CCCC(C)(CC)C(=O)OCCOc1ccc(C2(c3ccc(OCCOC)cc3)c3ccccc3-c3ccccc32)cc1.CCCCC |
| InChI | InChI=1S/C38H42O5.C5H12/c1-5-23-37(3,6-2)36(39)43-27-26-42-31-21-17-29(18-22-31)38(28-15-19-30(20-16-28)41-25-24-40-4)34-13-9-7-11-32(34)33-12-8-10-14-35(33)38;1-3-5-4-2/h7-22H,5-6,23-27H2,1-4H3;3-5H2,1-2H3 |
| InChIKey | MBJFYDXCFHNSMK-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|