C29H27O7P — CID 71033273
2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl dihydrogen phosphate (PubChem CID 71033273) has the molecular formula C29H27O7P and a molecular weight of 518.50 g/mol. Its IUPAC name is 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71033273 |
| Molecular Formula | C29H27O7P |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCOc1ccc(C2(c3ccc(OCCO)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C29H27O7P/c30-17-18-34-23-13-9-21(10-14-23)29(22-11-15-24(16-12-22)35-19-20-36-37(31,32)33)27-7-3-1-5-25(27)26-6-2-4-8-28(26)29/h1-16,30H,17-20H2,(H2,31,32,33) |
| InChIKey | QROQBKGZUNJVQC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|