C38H32O6S — CID 144725709
2-[6-[9-[6-(2-hydroxyethoxy)naphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyethyl methanesulfonate (PubChem CID 144725709) has the molecular formula C38H32O6S and a molecular weight of 616.73 g/mol. Its IUPAC name is 2-[6-[9-[6-(2-hydroxyethoxy)naphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyethyl methanesulfonate.
| Compound Name | 2-[6-[9-[6-(2-hydroxyethoxy)naphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyethyl methanesulfonate |
|---|---|
| PubChem CID | 144725709 |
| Molecular Formula | C38H32O6S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | 2-[6-[9-[6-(2-hydroxyethoxy)naphthalen-2-yl]fluoren-9-yl]naphthalen-2-yl]oxyethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOc1ccc2cc(C3(c4ccc5cc(OCCO)ccc5c4)c4ccccc4-c4ccccc43)ccc2c1 |
| InChI | InChI=1S/C38H32O6S/c1-45(40,41)44-21-20-43-33-17-13-27-23-31(15-11-29(27)25-33)38(36-8-4-2-6-34(36)35-7-3-5-9-37(35)38)30-14-10-28-24-32(42-19-18-39)16-12-26(28)22-30/h2-17,22-25,39H,18-21H2,1H3 |
| InChIKey | OLCRUIBJWHELMN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|