C36H38O5 — CID 126703897
2-ethyl-1-[2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethoxy]-2-methylbut-3-en-1-ol (PubChem CID 126703897) has the molecular formula C36H38O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-ethyl-1-[2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethoxy]-2-methylbut-3-en-1-ol.
| Compound Name | 2-ethyl-1-[2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethoxy]-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 126703897 |
| Molecular Formula | C36H38O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 2-ethyl-1-[2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethoxy]-2-methylbut-3-en-1-ol |
| SMILES | C=CC(C)(CC)C(O)OCCOc1ccc(C2(c3ccc(OCCO)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C36H38O5/c1-4-35(3,5-2)34(38)41-25-24-40-29-20-16-27(17-21-29)36(26-14-18-28(19-15-26)39-23-22-37)32-12-8-6-10-30(32)31-11-7-9-13-33(31)36/h4,6-21,34,37-38H,1,5,22-25H2,2-3H3 |
| InChIKey | DBENSIFGVDZTPZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|