C25H31NO3 — CID 58939408
6-[4-(4-cyanophenyl)phenoxy]hexyl 2,2-dimethylbutanoate (PubChem CID 58939408) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 6-[4-(4-cyanophenyl)phenoxy]hexyl 2,2-dimethylbutanoate.
| Compound Name | 6-[4-(4-cyanophenyl)phenoxy]hexyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58939408 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 6-[4-(4-cyanophenyl)phenoxy]hexyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCCCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-4-25(2,3)24(27)29-18-8-6-5-7-17-28-23-15-13-22(14-16-23)21-11-9-20(19-26)10-12-21/h9-16H,4-8,17-18H2,1-3H3 |
| InChIKey | MDEWRXQVAUBZLG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|