About (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate
(4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate (PubChem CID 54566931) has the molecular formula C23H31NO4
and a molecular weight of 385.50 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate |
| PubChem CID | 54566931 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate |
| SMILES | CCC(C)(C)C(=O)OCCCC1CCC(C(=O)Oc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C23H31NO4/c1-4-23(2,3)22(26)27-15-5-6-17-7-11-19(12-8-17)21(25)28-20-13-9-18(16-24)10-14-20/h9-10,13-14,17,19H,4-8,11-12,15H2,1-3H3 |
| InChIKey | ZUMINKMTHCGZPQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate?
The IUPAC name of (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate (CID 54566931) is (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate.
What is the SMILES notation for (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate?
The canonical SMILES for (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate is CCC(C)(C)C(=O)OCCCC1CCC(C(=O)Oc2ccc(C#N)cc2)CC1.
What is the InChIKey of (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate?
The InChIKey is ZUMINKMTHCGZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO4/c1-4-23(2,3)22(26)27-15-5-6-17-7-11-19(12-8-17)21(25)28-20-13-9-18(16-24)10-14-20/h9-10,13-14,17,19H,4-8,11-12,15H2,1-3H3.
What are the key properties of (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate?
(4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate has a molecular weight of 385.50 g/mol, XLogP of 5.03, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 4-[3-(2,2-dimethylbutanoyloxy)propyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 54566931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).