C23H32O3 — CID 101158431
(4-pent-4-ynoxyphenyl) 4-pentylcyclohexane-1-carboxylate (PubChem CID 101158431) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (4-pent-4-ynoxyphenyl) 4-pentylcyclohexane-1-carboxylate.
| Compound Name | (4-pent-4-ynoxyphenyl) 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101158431 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (4-pent-4-ynoxyphenyl) 4-pentylcyclohexane-1-carboxylate |
| SMILES | C#CCCCOc1ccc(OC(=O)C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C23H32O3/c1-3-5-7-9-19-10-12-20(13-11-19)23(24)26-22-16-14-21(15-17-22)25-18-8-6-4-2/h2,14-17,19-20H,3,5-13,18H2,1H3 |
| InChIKey | VTLTUKQAZAPCLB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|