C26H37NO2 — CID 54002942
(4-cyanophenyl) (2R,4aR)-6-octyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate (PubChem CID 54002942) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (4-cyanophenyl) (2R,4aR)-6-octyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate.
| Compound Name | (4-cyanophenyl) (2R,4aR)-6-octyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54002942 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | (4-cyanophenyl) (2R,4aR)-6-octyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCC1CCC2C[C@H](C(=O)Oc3ccc(C#N)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C26H37NO2/c1-2-3-4-5-6-7-8-20-9-12-23-18-24(14-13-22(23)17-20)26(28)29-25-15-10-21(19-27)11-16-25/h10-11,15-16,20,22-24H,2-9,12-14,17-18H2,1H3/t20?,22-,23?,24-/m1/s1 |
| InChIKey | KMWOXXBXTMSKAF-RSHDMXJRSA-N |
| XLogP | 7.05 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|