C22H32O2 — CID 54021161
(4-methylphenyl) (2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate (PubChem CID 54021161) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (4-methylphenyl) (2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate.
| Compound Name | (4-methylphenyl) (2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54021161 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4-methylphenyl) (2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
| SMILES | CCCCC1CCC2C[C@H](C(=O)Oc3ccc(C)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C22H32O2/c1-3-4-5-17-8-9-19-15-20(11-10-18(19)14-17)22(23)24-21-12-6-16(2)7-13-21/h6-7,12-13,17-20H,3-5,8-11,14-15H2,1-2H3/t17?,18-,19?,20-/m1/s1 |
| InChIKey | KYZXXQYFFHLRQB-CQJJOKNBSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|