C28H39F3O2 — CID 139868902
[4-(trifluoromethyl)phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139868902) has the molecular formula C28H39F3O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | [4-(trifluoromethyl)phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139868902 |
| Molecular Formula | C28H39F3O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC2CC(C3CCC(C(=O)Oc4ccc(C(F)(F)F)cc4)CC3)CCC2C1 |
| InChI | InChI=1S/C28H39F3O2/c1-2-3-4-19-5-6-24-18-23(12-11-22(24)17-19)20-7-9-21(10-8-20)27(32)33-26-15-13-25(14-16-26)28(29,30)31/h13-16,19-24H,2-12,17-18H2,1H3 |
| InChIKey | IUSMZKFZBFPOPU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|