C23H32F3NO2 — CID 19765728
[6-(trifluoromethyl)-3-pyridinyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 19765728) has the molecular formula C23H32F3NO2 and a molecular weight of 411.51 g/mol. Its IUPAC name is [6-(trifluoromethyl)-3-pyridinyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [6-(trifluoromethyl)-3-pyridinyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19765728 |
| Molecular Formula | C23H32F3NO2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [6-(trifluoromethyl)-3-pyridinyl] 4-(4-butylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C2CCC(C(=O)Oc3ccc(C(F)(F)F)nc3)CC2)CC1 |
| InChI | InChI=1S/C23H32F3NO2/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)22(28)29-20-13-14-21(27-15-20)23(24,25)26/h13-19H,2-12H2,1H3 |
| InChIKey | FIWWYVBDPCMUBD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |