C24H24F6N2O4 — CID 57141422
bis[6-(trifluoromethyl)-3-pyridinyl] 4-butylcyclohexane-1,1-dicarboxylate (PubChem CID 57141422) has the molecular formula C24H24F6N2O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is bis[6-(trifluoromethyl)-3-pyridinyl] 4-butylcyclohexane-1,1-dicarboxylate.
| Compound Name | bis[6-(trifluoromethyl)-3-pyridinyl] 4-butylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 57141422 |
| Molecular Formula | C24H24F6N2O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | bis[6-(trifluoromethyl)-3-pyridinyl] 4-butylcyclohexane-1,1-dicarboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(C(F)(F)F)nc2)(C(=O)Oc2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C24H24F6N2O4/c1-2-3-4-15-9-11-22(12-10-15,20(33)35-16-5-7-18(31-13-16)23(25,26)27)21(34)36-17-6-8-19(32-14-17)24(28,29)30/h5-8,13-15H,2-4,9-12H2,1H3 |
| InChIKey | AKSPWJHTEZRWOP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|