About (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate
(6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate (PubChem CID 19765611) has the molecular formula C15H20FNO2
and a molecular weight of 265.33 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate |
| PubChem CID | 19765611 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C(=O)Oc2ccc(F)nc2)CC1 |
| InChI | InChI=1S/C15H20FNO2/c1-2-3-11-4-6-12(7-5-11)15(18)19-13-8-9-14(16)17-10-13/h8-12H,2-7H2,1H3 |
| InChIKey | VUWOJQKFVKCDEU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate?
The IUPAC name of (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate (CID 19765611) is (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate.
What is the SMILES notation for (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate?
The canonical SMILES for (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate is CCCC1CCC(C(=O)Oc2ccc(F)nc2)CC1.
What is the InChIKey of (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate?
The InChIKey is VUWOJQKFVKCDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2/c1-2-3-11-4-6-12(7-5-11)15(18)19-13-8-9-14(16)17-10-13/h8-12H,2-7H2,1H3.
What are the key properties of (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate?
(6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate has a molecular weight of 265.33 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-3-pyridinyl) 4-propylcyclohexane-1-carboxylate is sourced from PubChem (CID 19765611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).