C32H48O2 — CID 139870113
[4-[(E)-pent-3-enyl]phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139870113) has the molecular formula C32H48O2 and a molecular weight of 464.73 g/mol. Its IUPAC name is [4-[(E)-pent-3-enyl]phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-pent-3-enyl]phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139870113 |
| Molecular Formula | C32H48O2 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | [4-[(E)-pent-3-enyl]phenyl] 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | C/C=C/CCc1ccc(OC(=O)C2CCC(C3CCC4CC(CCCC)CCC4C3)CC2)cc1 |
| InChI | InChI=1S/C32H48O2/c1-3-5-7-9-24-11-20-31(21-12-24)34-32(33)27-16-14-26(15-17-27)29-19-18-28-22-25(8-6-4-2)10-13-30(28)23-29/h3,5,11-12,20-21,25-30H,4,6-10,13-19,22-23H2,1-2H3/b5-3+ |
| InChIKey | TWFIJZNOWZONJI-HWKANZROSA-N |
| XLogP | 8.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|