C22H22N2O3 — CID 143609444
2-[4-(4-cyanophenyl)phenoxy]ethyl 4-cyano-4-methylpentanoate (PubChem CID 143609444) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenoxy]ethyl 4-cyano-4-methylpentanoate.
| Compound Name | 2-[4-(4-cyanophenyl)phenoxy]ethyl 4-cyano-4-methylpentanoate |
|---|---|
| PubChem CID | 143609444 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenoxy]ethyl 4-cyano-4-methylpentanoate |
| SMILES | CC(C)(C#N)CCC(=O)OCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-22(2,16-24)12-11-21(25)27-14-13-26-20-9-7-19(8-10-20)18-5-3-17(15-23)4-6-18/h3-10H,11-14H2,1-2H3 |
| InChIKey | FZWLRVOYKZGMCE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|