C49H44F14N2O6 — CID 132510517
[9-[7-[4-(4-cyanophenyl)phenoxy]heptanoyloxy]-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononyl] 7-[4-(4-cyanophenyl)phenoxy]heptanoate (PubChem CID 132510517) has the molecular formula C49H44F14N2O6 and a molecular weight of 1022.87 g/mol. Its IUPAC name is [9-[7-[4-(4-cyanophenyl)phenoxy]heptanoyloxy]-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononyl] 7-[4-(4-cyanophenyl)phenoxy]heptanoate.
| Compound Name | [9-[7-[4-(4-cyanophenyl)phenoxy]heptanoyloxy]-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononyl] 7-[4-(4-cyanophenyl)phenoxy]heptanoate |
|---|---|
| PubChem CID | 132510517 |
| Molecular Formula | C49H44F14N2O6 |
| Molecular Weight | 1022.87 g/mol |
| Exact Mass | 1022.30 |
| IUPAC Name | [9-[7-[4-(4-cyanophenyl)phenoxy]heptanoyloxy]-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononyl] 7-[4-(4-cyanophenyl)phenoxy]heptanoate |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(=O)CCCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C49H44F14N2O6/c50-43(51,31-70-41(66)9-5-1-3-7-27-68-39-23-19-37(20-24-39)35-15-11-33(29-64)12-16-35)45(54,55)47(58,59)49(62,63)48(60,61)46(56,57)44(52,53)32-71-42(67)10-6-2-4-8-28-69-40-25-21-38(22-26-40)36-17-13-34(30-65)14-18-36/h11-26H,1-10,27-28,31-32H2 |
| InChIKey | UTTDZHFVUSJFHB-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.87 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|