C23H29N3O4S — CID 19020022
2-[N-methyl-4-[[4-(2-methylbutylsulfonyl)phenyl]diazenyl]anilino]ethyl prop-2-enoate (PubChem CID 19020022) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[N-methyl-4-[[4-(2-methylbutylsulfonyl)phenyl]diazenyl]anilino]ethyl prop-2-enoate.
| Compound Name | 2-[N-methyl-4-[[4-(2-methylbutylsulfonyl)phenyl]diazenyl]anilino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 19020022 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[N-methyl-4-[[4-(2-methylbutylsulfonyl)phenyl]diazenyl]anilino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)CC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-5-18(3)17-31(28,29)22-13-9-20(10-14-22)25-24-19-7-11-21(12-8-19)26(4)15-16-30-23(27)6-2/h6-14,18H,2,5,15-17H2,1,3-4H3/b25-24+ |
| InChIKey | PEEMFBYAVWQAIV-OCOZRVBESA-N |
| XLogP | 5.09 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|