C26H25NO4S — CID 54481432
2-[4-[2-[4-(benzenesulfonyl)phenyl]ethenyl]-N-methylanilino]ethyl prop-2-enoate (PubChem CID 54481432) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[4-[2-[4-(benzenesulfonyl)phenyl]ethenyl]-N-methylanilino]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-(benzenesulfonyl)phenyl]ethenyl]-N-methylanilino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 54481432 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[4-[2-[4-(benzenesulfonyl)phenyl]ethenyl]-N-methylanilino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)c1ccc(C=Cc2ccc(S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H25NO4S/c1-3-26(28)31-20-19-27(2)23-15-11-21(12-16-23)9-10-22-13-17-25(18-14-22)32(29,30)24-7-5-4-6-8-24/h3-18H,1,19-20H2,2H3 |
| InChIKey | XPGGWVRTINIHRT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|