C30H31N3O4 — CID 59899751
2-[4-[4-[[methyl(phenyl)hydrazinylidene]methyl]-N-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate (PubChem CID 59899751) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[4-[4-[[methyl(phenyl)hydrazinylidene]methyl]-N-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[4-[[methyl(phenyl)hydrazinylidene]methyl]-N-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59899751 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[4-[4-[[methyl(phenyl)hydrazinylidene]methyl]-N-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(CCOC(=O)C=C)c2ccc(C=NN(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H31N3O4/c1-4-29(34)36-21-19-24-11-15-27(16-12-24)33(20-22-37-30(35)5-2)28-17-13-25(14-18-28)23-31-32(3)26-9-7-6-8-10-26/h4-18,23H,1-2,19-22H2,3H3 |
| InChIKey | AQVXLSCEPGJWGF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|