About 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride
2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride (PubChem CID 174580927) has the molecular formula C14H23ClN2O2
and a molecular weight of 286.80 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride |
| PubChem CID | 174580927 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride |
| SMILES | C=CC(=O)OCCN(C)C.Cl.NCc1ccccc1 |
| InChI | InChI=1S/C7H13NO2.C7H9N.ClH/c1-4-7(9)10-6-5-8(2)3;8-6-7-4-2-1-3-5-7;/h4H,1,5-6H2,2-3H3;1-5H,6,8H2;1H |
| InChIKey | LVAVENFODUFSOQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride (CID 174580927) is 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride is C=CC(=O)OCCN(C)C.Cl.NCc1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride?
The InChIKey is LVAVENFODUFSOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C7H9N.ClH/c1-4-7(9)10-6-5-8(2)3;8-6-7-4-2-1-3-5-7;/h4H,1,5-6H2,2-3H3;1-5H,6,8H2;1H.
What are the key properties of 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride?
2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride has a molecular weight of 286.80 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl prop-2-enoate;phenylmethanamine;hydrochloride is sourced from PubChem (CID 174580927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).