C14H23ClN2O2 — CID 175003211
4-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride (PubChem CID 175003211) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 4-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride.
| Compound Name | 4-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 175003211 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride |
| SMILES | C=C(CCN(C)C)C(=O)O.Cl.NCc1ccccc1 |
| InChI | InChI=1S/C7H13NO2.C7H9N.ClH/c1-6(7(9)10)4-5-8(2)3;8-6-7-4-2-1-3-5-7;/h1,4-5H2,2-3H3,(H,9,10);1-5H,6,8H2;1H |
| InChIKey | IXWDMBJABKXWJX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|