About 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride
3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride (PubChem CID 175003213) has the molecular formula C14H23ClN2O2
and a molecular weight of 286.80 g/mol. Its IUPAC name is 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride |
| PubChem CID | 175003213 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride |
| SMILES | C=C(C(=O)O)C(C)N(C)C.Cl.NCc1ccccc1 |
| InChI | InChI=1S/C7H13NO2.C7H9N.ClH/c1-5(7(9)10)6(2)8(3)4;8-6-7-4-2-1-3-5-7;/h6H,1H2,2-4H3,(H,9,10);1-5H,6,8H2;1H |
| InChIKey | WXQZVCCHCGDDKK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride?
The IUPAC name of 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride (CID 175003213) is 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride?
The canonical SMILES for 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride is C=C(C(=O)O)C(C)N(C)C.Cl.NCc1ccccc1.
What is the InChIKey of 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride?
The InChIKey is WXQZVCCHCGDDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C7H9N.ClH/c1-5(7(9)10)6(2)8(3)4;8-6-7-4-2-1-3-5-7;/h6H,1H2,2-4H3,(H,9,10);1-5H,6,8H2;1H.
What are the key properties of 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride?
3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride has a molecular weight of 286.80 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-2-methylidenebutanoic acid;phenylmethanamine;hydrochloride is sourced from PubChem (CID 175003213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).