About 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine
1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine (PubChem CID 174596422) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine |
| PubChem CID | 174596422 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine |
| SMILES | C=C(C)C(=O)OC(C)N(C)C.NCc1ccccc1 |
| InChI | InChI=1S/C8H15NO2.C7H9N/c1-6(2)8(10)11-7(3)9(4)5;8-6-7-4-2-1-3-5-7/h7H,1H2,2-5H3;1-5H,6,8H2 |
| InChIKey | GRQVXYQBFIUKLW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine?
The IUPAC name of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine (CID 174596422) is 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine?
The canonical SMILES for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine is C=C(C)C(=O)OC(C)N(C)C.NCc1ccccc1.
What is the InChIKey of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine?
The InChIKey is GRQVXYQBFIUKLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C7H9N/c1-6(2)8(10)11-7(3)9(4)5;8-6-7-4-2-1-3-5-7/h7H,1H2,2-5H3;1-5H,6,8H2.
What are the key properties of 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine?
1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine has a molecular weight of 264.37 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-methylprop-2-enoate;phenylmethanamine is sourced from PubChem (CID 174596422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).