About 1-(dimethylamino)ethyl 2-phenylacetate
1-(dimethylamino)ethyl 2-phenylacetate (PubChem CID 88661320) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-phenylacetate.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-phenylacetate |
| PubChem CID | 88661320 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-phenylacetate |
| SMILES | CC(OC(=O)Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C12H17NO2/c1-10(13(2)3)15-12(14)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | UTMSGNBFHMJSEA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-phenylacetate?
The IUPAC name of 1-(dimethylamino)ethyl 2-phenylacetate (CID 88661320) is 1-(dimethylamino)ethyl 2-phenylacetate.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-phenylacetate?
The canonical SMILES for 1-(dimethylamino)ethyl 2-phenylacetate is CC(OC(=O)Cc1ccccc1)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl 2-phenylacetate?
The InChIKey is UTMSGNBFHMJSEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-10(13(2)3)15-12(14)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3.
What are the key properties of 1-(dimethylamino)ethyl 2-phenylacetate?
1-(dimethylamino)ethyl 2-phenylacetate has a molecular weight of 207.27 g/mol, XLogP of 1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-phenylacetate is sourced from PubChem (CID 88661320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).