About 1-bromoethyl 2-phenylacetate
1-bromoethyl 2-phenylacetate (PubChem CID 22386448) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is 1-bromoethyl 2-phenylacetate.
Molecular Properties
| Compound Name | 1-bromoethyl 2-phenylacetate |
| PubChem CID | 22386448 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1-bromoethyl 2-phenylacetate |
| SMILES | CC(Br)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C10H11BrO2/c1-8(11)13-10(12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | QLDSONHYYNIMPG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethyl 2-phenylacetate?
The IUPAC name of 1-bromoethyl 2-phenylacetate (CID 22386448) is 1-bromoethyl 2-phenylacetate.
What is the SMILES notation for 1-bromoethyl 2-phenylacetate?
The canonical SMILES for 1-bromoethyl 2-phenylacetate is CC(Br)OC(=O)Cc1ccccc1.
What is the InChIKey of 1-bromoethyl 2-phenylacetate?
The InChIKey is QLDSONHYYNIMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-8(11)13-10(12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What are the key properties of 1-bromoethyl 2-phenylacetate?
1-bromoethyl 2-phenylacetate has a molecular weight of 243.10 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethyl 2-phenylacetate is sourced from PubChem (CID 22386448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).