About S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate
S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate (PubChem CID 174931571) has the molecular formula C15H25NO2S
and a molecular weight of 283.44 g/mol. Its IUPAC name is S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate.
Molecular Properties
| Compound Name | S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate |
| PubChem CID | 174931571 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate |
| SMILES | CC(C)(C)SN.CC(C)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H14O2.C4H11NS/c1-9(2)13-11(12)8-10-6-4-3-5-7-10;1-4(2,3)6-5/h3-7,9H,8H2,1-2H3;5H2,1-3H3 |
| InChIKey | ZHJVSBZCKQBMMI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate?
The IUPAC name of S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate (CID 174931571) is S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate.
What is the SMILES notation for S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate?
The canonical SMILES for S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate is CC(C)(C)SN.CC(C)OC(=O)Cc1ccccc1.
What is the InChIKey of S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate?
The InChIKey is ZHJVSBZCKQBMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C4H11NS/c1-9(2)13-11(12)8-10-6-4-3-5-7-10;1-4(2,3)6-5/h3-7,9H,8H2,1-2H3;5H2,1-3H3.
What are the key properties of S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate?
S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate has a molecular weight of 283.44 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butylthiohydroxylamine;propan-2-yl 2-phenylacetate is sourced from PubChem (CID 174931571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).