About 1-(dimethylamino)ethyl 2-hydroxyacetate
1-(dimethylamino)ethyl 2-hydroxyacetate (PubChem CID 154486667) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl 2-hydroxyacetate |
| PubChem CID | 154486667 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 1-(dimethylamino)ethyl 2-hydroxyacetate |
| SMILES | CC(OC(=O)CO)N(C)C |
| InChI | InChI=1S/C6H13NO3/c1-5(7(2)3)10-6(9)4-8/h5,8H,4H2,1-3H3 |
| InChIKey | AQUSFFFPZFBFPI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl 2-hydroxyacetate?
The IUPAC name of 1-(dimethylamino)ethyl 2-hydroxyacetate (CID 154486667) is 1-(dimethylamino)ethyl 2-hydroxyacetate.
What is the SMILES notation for 1-(dimethylamino)ethyl 2-hydroxyacetate?
The canonical SMILES for 1-(dimethylamino)ethyl 2-hydroxyacetate is CC(OC(=O)CO)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl 2-hydroxyacetate?
The InChIKey is AQUSFFFPZFBFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-5(7(2)3)10-6(9)4-8/h5,8H,4H2,1-3H3.
What are the key properties of 1-(dimethylamino)ethyl 2-hydroxyacetate?
1-(dimethylamino)ethyl 2-hydroxyacetate has a molecular weight of 147.17 g/mol, XLogP of -0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl 2-hydroxyacetate is sourced from PubChem (CID 154486667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).