About 1-(dimethylamino)propan-2-yl 2-hydroxyacetate
1-(dimethylamino)propan-2-yl 2-hydroxyacetate (PubChem CID 175391300) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-(dimethylamino)propan-2-yl 2-hydroxyacetate.
Molecular Properties
| Compound Name | 1-(dimethylamino)propan-2-yl 2-hydroxyacetate |
| PubChem CID | 175391300 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 1-(dimethylamino)propan-2-yl 2-hydroxyacetate |
| SMILES | CC(CN(C)C)OC(=O)CO |
| InChI | InChI=1S/C7H15NO3/c1-6(4-8(2)3)11-7(10)5-9/h6,9H,4-5H2,1-3H3 |
| InChIKey | BVGZDGDMXQWZFW-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(dimethylamino)propan-2-yl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)propan-2-yl 2-hydroxyacetate?
The IUPAC name of 1-(dimethylamino)propan-2-yl 2-hydroxyacetate (CID 175391300) is 1-(dimethylamino)propan-2-yl 2-hydroxyacetate.
What is the SMILES notation for 1-(dimethylamino)propan-2-yl 2-hydroxyacetate?
The canonical SMILES for 1-(dimethylamino)propan-2-yl 2-hydroxyacetate is CC(CN(C)C)OC(=O)CO.
What is the InChIKey of 1-(dimethylamino)propan-2-yl 2-hydroxyacetate?
The InChIKey is BVGZDGDMXQWZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3/c1-6(4-8(2)3)11-7(10)5-9/h6,9H,4-5H2,1-3H3.
What are the key properties of 1-(dimethylamino)propan-2-yl 2-hydroxyacetate?
1-(dimethylamino)propan-2-yl 2-hydroxyacetate has a molecular weight of 161.20 g/mol, XLogP of -0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)propan-2-yl 2-hydroxyacetate is sourced from PubChem (CID 175391300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).