C12H25N3O2 — CID 112741380
1-(dimethylamino)propan-2-yl 2-(1,4-diazepan-1-yl)acetate (PubChem CID 112741380) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-(dimethylamino)propan-2-yl 2-(1,4-diazepan-1-yl)acetate.
| Compound Name | 1-(dimethylamino)propan-2-yl 2-(1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 112741380 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 1-(dimethylamino)propan-2-yl 2-(1,4-diazepan-1-yl)acetate |
| SMILES | CC(CN(C)C)OC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C12H25N3O2/c1-11(9-14(2)3)17-12(16)10-15-7-4-5-13-6-8-15/h11,13H,4-10H2,1-3H3 |
| InChIKey | NJJZZSVJTACOOO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |