About butan-2-yl 2-(dimethylamino)acetate
butan-2-yl 2-(dimethylamino)acetate (PubChem CID 134215874) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is butan-2-yl 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | butan-2-yl 2-(dimethylamino)acetate |
| PubChem CID | 134215874 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | butan-2-yl 2-(dimethylamino)acetate |
| SMILES | CCC(C)OC(=O)CN(C)C |
| InChI | InChI=1S/C8H17NO2/c1-5-7(2)11-8(10)6-9(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | GJQYWPQPIMVDOM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-2-yl 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-(dimethylamino)acetate?
The IUPAC name of butan-2-yl 2-(dimethylamino)acetate (CID 134215874) is butan-2-yl 2-(dimethylamino)acetate.
What is the SMILES notation for butan-2-yl 2-(dimethylamino)acetate?
The canonical SMILES for butan-2-yl 2-(dimethylamino)acetate is CCC(C)OC(=O)CN(C)C.
What is the InChIKey of butan-2-yl 2-(dimethylamino)acetate?
The InChIKey is GJQYWPQPIMVDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-5-7(2)11-8(10)6-9(3)4/h7H,5-6H2,1-4H3.
What are the key properties of butan-2-yl 2-(dimethylamino)acetate?
butan-2-yl 2-(dimethylamino)acetate has a molecular weight of 159.23 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-(dimethylamino)acetate is sourced from PubChem (CID 134215874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).