About butan-2-yl 3-oxopropanoate
butan-2-yl 3-oxopropanoate (PubChem CID 91092014) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is butan-2-yl 3-oxopropanoate.
Molecular Properties
| Compound Name | butan-2-yl 3-oxopropanoate |
| PubChem CID | 91092014 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | butan-2-yl 3-oxopropanoate |
| SMILES | CCC(C)OC(=O)CC=O |
| InChI | InChI=1S/C7H12O3/c1-3-6(2)10-7(9)4-5-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | BROPJXAERQXUTH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 3-oxopropanoate?
The IUPAC name of butan-2-yl 3-oxopropanoate (CID 91092014) is butan-2-yl 3-oxopropanoate.
What is the SMILES notation for butan-2-yl 3-oxopropanoate?
The canonical SMILES for butan-2-yl 3-oxopropanoate is CCC(C)OC(=O)CC=O.
What is the InChIKey of butan-2-yl 3-oxopropanoate?
The InChIKey is BROPJXAERQXUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-6(2)10-7(9)4-5-8/h5-6H,3-4H2,1-2H3.
What are the key properties of butan-2-yl 3-oxopropanoate?
butan-2-yl 3-oxopropanoate has a molecular weight of 144.17 g/mol, XLogP of 0.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 3-oxopropanoate is sourced from PubChem (CID 91092014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).