About butan-2-yl 4-methylhexanoate
butan-2-yl 4-methylhexanoate (PubChem CID 137387388) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is butan-2-yl 4-methylhexanoate.
Molecular Properties
| Compound Name | butan-2-yl 4-methylhexanoate |
| PubChem CID | 137387388 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | butan-2-yl 4-methylhexanoate |
| SMILES | CCC(C)CCC(=O)OC(C)CC |
| InChI | InChI=1S/C11H22O2/c1-5-9(3)7-8-11(12)13-10(4)6-2/h9-10H,5-8H2,1-4H3 |
| InChIKey | HZWCRFKBSVWWMI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-yl 4-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 4-methylhexanoate?
The IUPAC name of butan-2-yl 4-methylhexanoate (CID 137387388) is butan-2-yl 4-methylhexanoate.
What is the SMILES notation for butan-2-yl 4-methylhexanoate?
The canonical SMILES for butan-2-yl 4-methylhexanoate is CCC(C)CCC(=O)OC(C)CC.
What is the InChIKey of butan-2-yl 4-methylhexanoate?
The InChIKey is HZWCRFKBSVWWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-5-9(3)7-8-11(12)13-10(4)6-2/h9-10H,5-8H2,1-4H3.
What are the key properties of butan-2-yl 4-methylhexanoate?
butan-2-yl 4-methylhexanoate has a molecular weight of 186.29 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 4-methylhexanoate is sourced from PubChem (CID 137387388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).